CAS 80076-50-2 appears in our catalog under these names: 5,6-difluoro-2-methylquinoline, Nadifloxacin Impurity 7. Offered by: Chemat Brand. Available pack sizes: on request.
5,6-difluoro-2-methylquinoline (CAS 80076-50-2) is a chemical compound with the molecular formula C10H7F2N and a molecular weight of 179.17 g/mol. IUPAC name: 5,6-difluoro-2-methylquinoline. InChIKey: UQKAMONIMDBCIM-UHFFFAOYSA-N.
| Molecular formula | C10H7F2N |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 5,6-difluoro-2-methylquinoline |
| InChIKey | UQKAMONIMDBCIM-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C(=C(C=C2)F)F |
Computed by PubChem (NCBI)