CAS 80082-51-5 appears in our catalog under these names: (2R,3S)-4-Amino-3-(((benzyloxy)carbonyl)amino)-4-oxobutan-2-yl methanesulfonate, 98%, N-Benzyloxycarbonyl L-Threonine Amide O-Methanesulfonate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 2,5g, 250mg.
[(2R,3S)-4-amino-4-oxo-3-(phenylmethoxycarbonylamino)butan-2-yl] methanesulfonate (CAS 80082-51-5) is a chemical compound with the molecular formula C13H18N2O6S and a molecular weight of 330.36 g/mol. IUPAC name: [(2R,3S)-4-amino-4-oxo-3-(phenylmethoxycarbonylamino)butan-2-yl] methanesulfonate. InChIKey: FKFRPOGPNHJBGP-KOLCDFICSA-N.
| Molecular formula | C13H18N2O6S |
|---|---|
| Molecular weight | 330.36 g/mol |
| IUPAC name | [(2R,3S)-4-amino-4-oxo-3-(phenylmethoxycarbonylamino)butan-2-yl] methanesulfonate |
| InChIKey | FKFRPOGPNHJBGP-KOLCDFICSA-N |
| SMILES | C[C@H]([C@@H](C(=O)N)NC(=O)OCC1=CC=CC=C1)OS(=O)(=O)C |
Computed by PubChem (NCBI)