CAS 80083-37-0 is the registry number for N,N,N–Triethyl–2–hydrazinyl–2–oxoethanaminium chloride. Offered by: GLPBio. Available pack sizes: 100mg.
Triethyl-(2-hydrazinyl-2-oxoethyl)azanium chloride (CAS 80083-37-0) is a chemical compound with the molecular formula C8H20ClN3O and a molecular weight of 209.72 g/mol. IUPAC name: triethyl-(2-hydrazinyl-2-oxoethyl)azanium chloride. InChIKey: CTGICVUAEJSASS-UHFFFAOYSA-N.
| Molecular formula | C8H20ClN3O |
|---|---|
| Molecular weight | 209.72 g/mol |
| IUPAC name | triethyl-(2-hydrazinyl-2-oxoethyl)azanium chloride |
| InChIKey | CTGICVUAEJSASS-UHFFFAOYSA-N |
| SMILES | CC[N+](CC)(CC)CC(=O)NN.[Cl-] |
Computed by PubChem (NCBI)