CAS 80087-69-0 appears in our catalog under these names: 5,6–Dichloro–1,3–benzothiazole–2(3H)–thione, 2(3H)-Benzothiazolethione, 5,6-dichloro-, 97%, 97%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 5g.
5,6-dichloro-3H-1,3-benzothiazole-2-thione (CAS 80087-69-0) is a chemical compound with the molecular formula C7H3Cl2NS2 and a molecular weight of 236.1 g/mol. IUPAC name: 5,6-dichloro-3H-1,3-benzothiazole-2-thione. InChIKey: JAHGNXIJPWTQNB-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2NS2 |
|---|---|
| Molecular weight | 236.1 g/mol |
| IUPAC name | 5,6-dichloro-3H-1,3-benzothiazole-2-thione |
| InChIKey | JAHGNXIJPWTQNB-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)Cl)SC(=S)N2 |
Computed by PubChem (NCBI)