Products 801-72-9
CAS 801-72-9 appears in our catalog under these names: Vitamin A Impurity 41, Retinol Impurity 4, 5,6-Monoepoxyretinyl Acetate, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg.
[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl)nona-2,4,6,8-tetraenyl] acetate (CAS 801-72-9) is a chemical compound with the molecular formula C22H32O3 and a molecular weight of 344.5 g/mol. IUPAC name: [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl)nona-2,4,6,8-tetraenyl] acetate. InChIKey: AZAWTSYUQKXIGK-IZVRVYHKSA-N.
| Molecular formula | C22H32O3 |
|---|---|
| Molecular weight | 344.5 g/mol |
| IUPAC name | [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl)nona-2,4,6,8-tetraenyl] acetate |
| InChIKey | AZAWTSYUQKXIGK-IZVRVYHKSA-N |
| SMILES | C/C(=C\COC(=O)C)/C=C/C=C(\C)/C=C/C12C(CCCC1(O2)C)(C)C |
Computed by PubChem (NCBI)