CAS 8013-17-0 appears in our catalog under these names: aldehydo-D-glucose, keto-D-fructose, 95%, Invert sugar, Invertose, Invertose, 99%(HPLC), 99%(HPLC), Invert sugar, 99.1%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, MedChemExpress. Available pack sizes: 5g, 25g, 1g, 2g, 1 g, 100 mg.
2,3,4,5,6-pentahydroxyhexanal;1,3,4,5,6-pentahydroxyhexan-2-one (CAS 8013-17-0) is a chemical compound with the molecular formula C12H24O12 and a molecular weight of 360.31 g/mol. IUPAC name: 2,3,4,5,6-pentahydroxyhexanal;1,3,4,5,6-pentahydroxyhexan-2-one. InChIKey: PJVXUVWGSCCGHT-UHFFFAOYSA-N.
| Molecular formula | C12H24O12 |
|---|---|
| Molecular weight | 360.31 g/mol |
| IUPAC name | 2,3,4,5,6-pentahydroxyhexanal;1,3,4,5,6-pentahydroxyhexan-2-one |
| InChIKey | PJVXUVWGSCCGHT-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C=O)O)O)O)O)O.C(C(C(C(C(=O)CO)O)O)O)O |
Computed by PubChem (NCBI)