CAS 8013-89-6 appears in our catalog under these names: Citrate-dextrose Solution (ACD), Citrate–dextrose solution (ACD), CITRATE-DEXTROSE SOLUTION. Offered by: TRC, GLPBio, Sigma-Aldrich. Available pack sizes: 100ml, 50ml, 10X50ML.
2-hydroxypropane-1,2,3-tricarboxylic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal (CAS 8013-89-6) is a chemical compound with the molecular formula C12H20O13 and a molecular weight of 372.28 g/mol. IUPAC name: 2-hydroxypropane-1,2,3-tricarboxylic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal. InChIKey: IJRKANNOPXMZSG-SSPAHAAFSA-N.
| Molecular formula | C12H20O13 |
|---|---|
| Molecular weight | 372.28 g/mol |
| IUPAC name | 2-hydroxypropane-1,2,3-tricarboxylic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
| InChIKey | IJRKANNOPXMZSG-SSPAHAAFSA-N |
| SMILES | C([C@H]([C@H]([C@@H]([C@H](C=O)O)O)O)O)O.C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
Computed by PubChem (NCBI)