CAS 80153-82-8 appears in our catalog under these names: Perfluoro-3,6-dioxaoctanoic acid, Perfluoro-(2-ethyloxyethoxy)acetic acid. Offered by: Dr. Ehrenstorfer, Biosynth. Available pack sizes: 10mg, 1g.
2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]acetic acid (CAS 80153-82-8) is a chemical compound with the molecular formula C6HF11O4 and a molecular weight of 346.05 g/mol. IUPAC name: 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]acetic acid. InChIKey: HDLFODOGTBJVKF-UHFFFAOYSA-N.
| Molecular formula | C6HF11O4 |
|---|---|
| Molecular weight | 346.05 g/mol |
| IUPAC name | 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]acetic acid |
| InChIKey | HDLFODOGTBJVKF-UHFFFAOYSA-N |
| SMILES | C(=O)(C(OC(C(OC(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)