CAS 80156-55-4 appears in our catalog under these names: (±)-1,2-Propanediol-d8, 98 atom % D, min 98% Chemical Purity, 1,2–propanediol–D8, 1,2-PROPANEDIOL-D8, 98 ATOM % D, (±)-1,2-Propanediol-d8, 99.55%. Offered by: CDN, GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 1g, 0,5g, 10mg, 5G, 500 mg, 100 mg, 250 mg, 50 mg.
1,1,1,2,3,3-hexadeuterio-2,3-dideuteriooxypropane (CAS 80156-55-4) is a chemical compound with the molecular formula C3H8O2 and a molecular weight of 84.14 g/mol. IUPAC name: 1,1,1,2,3,3-hexadeuterio-2,3-dideuteriooxypropane. InChIKey: DNIAPMSPPWPWGF-INOGVRQUSA-N.
| Molecular formula | C3H8O2 |
|---|---|
| Molecular weight | 84.14 g/mol |
| IUPAC name | 1,1,1,2,3,3-hexadeuterio-2,3-dideuteriooxypropane |
| InChIKey | DNIAPMSPPWPWGF-INOGVRQUSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])O[2H])O[2H] |
Computed by PubChem (NCBI)