CAS 80173-27-9 appears in our catalog under these names: H-Cys(Bzl)-AMC, H–Cys(Bzl)–AMC, S-Benzyl-L-cysteine 7-amido-4-methylcoumarin. Offered by: Creative Peptides, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 50mg, 250mg, 100mg, 500mg, Get quote.
(2S)-2-amino-3-benzylsulfanyl-N-(4-methyl-2-oxochromen-7-yl)propanamide (CAS 80173-27-9) is a chemical compound with the molecular formula C20H20N2O3S and a molecular weight of 368.5 g/mol. IUPAC name: (2S)-2-amino-3-benzylsulfanyl-N-(4-methyl-2-oxochromen-7-yl)propanamide. InChIKey: WSBODWFAIQZWSU-QGZVFWFLSA-N.
| Molecular formula | C20H20N2O3S |
|---|---|
| Molecular weight | 368.5 g/mol |
| IUPAC name | (2S)-2-amino-3-benzylsulfanyl-N-(4-methyl-2-oxochromen-7-yl)propanamide |
| InChIKey | WSBODWFAIQZWSU-QGZVFWFLSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@@H](CSCC3=CC=CC=C3)N |
Computed by PubChem (NCBI)