Products 802305-49-3

CAS 802305-49-3 is the registry number for a,a-Dimethyl-1-piperidineacetic acid, 98%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

1-propan-2-ylpiperidine-4-carboxylic acid (CAS 802305-49-3) is a chemical compound with the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. IUPAC name: 1-propan-2-ylpiperidine-4-carboxylic acid. InChIKey: QDOQCOOUTPQMKW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H17NO2
Molecular weight171.24 g/mol
IUPAC name1-propan-2-ylpiperidine-4-carboxylic acid
InChIKeyQDOQCOOUTPQMKW-UHFFFAOYSA-N
SMILESCC(C)N1CCC(CC1)C(=O)O

Computed by PubChem (NCBI)