CAS 80254-86-0 is the registry number for Methyl 3'-fluoro[1,1'-biphenyl]-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 4-(3-fluorophenyl)benzoate (CAS 80254-86-0) is a chemical compound with the molecular formula C14H11FO2 and a molecular weight of 230.23 g/mol. IUPAC name: methyl 4-(3-fluorophenyl)benzoate. InChIKey: RPBKPXWUZYCBNJ-UHFFFAOYSA-N.
| Molecular formula | C14H11FO2 |
|---|---|
| Molecular weight | 230.23 g/mol |
| IUPAC name | methyl 4-(3-fluorophenyl)benzoate |
| InChIKey | RPBKPXWUZYCBNJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)