Products 80277-14-1
CAS 80277-14-1 is the registry number for Amsacrine Isothionate. Offered by: TargetMol. Available pack sizes: 25mg, 50mg, 100mg.
N-[4-(acridin-9-ylamino)-3-methoxyphenyl]methanesulfonamide;2-hydroxyethanesulfonic acid (CAS 80277-14-1) is a chemical compound with the molecular formula C23H25N3O7S2 and a molecular weight of 519.6 g/mol. IUPAC name: N-[4-(acridin-9-ylamino)-3-methoxyphenyl]methanesulfonamide;2-hydroxyethanesulfonic acid. InChIKey: MZLUSXXMFJMTRB-UHFFFAOYSA-N.
| Molecular formula | C23H25N3O7S2 |
|---|---|
| Molecular weight | 519.6 g/mol |
| IUPAC name | N-[4-(acridin-9-ylamino)-3-methoxyphenyl]methanesulfonamide;2-hydroxyethanesulfonic acid |
| InChIKey | MZLUSXXMFJMTRB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)NS(=O)(=O)C)NC2=C3C=CC=CC3=NC4=CC=CC=C42.C(CS(=O)(=O)O)O |
Computed by PubChem (NCBI)