CAS 802904-66-1 appears in our catalog under these names: AZD 1981, AZD1981, AZD1981/ 99.54% (existing batch purity), AZD1981 99%, 2-(4-Acetamido-3-((4-chlorophenyl)thio)-2-methyl-1H-indol-1-yl)acetic acid, 99%, 99%. Offered by: TRC, GLPBio, TargetMol, Ambeed, Chemat. Available pack sizes: 100mg, 25mg, 5mg, 10mM (in 1ml dmso), 10mg, 50mg, 200mg, 1mg.
2-[4-acetamido-3-(4-chlorophenyl)sulfanyl-2-methylindol-1-yl]acetic acid (CAS 802904-66-1) is a chemical compound with the molecular formula C19H17ClN2O3S and a molecular weight of 388.9 g/mol. IUPAC name: 2-[4-acetamido-3-(4-chlorophenyl)sulfanyl-2-methylindol-1-yl]acetic acid. InChIKey: JWYIGNODXSRKGP-UHFFFAOYSA-N.
| Molecular formula | C19H17ClN2O3S |
|---|---|
| Molecular weight | 388.9 g/mol |
| IUPAC name | 2-[4-acetamido-3-(4-chlorophenyl)sulfanyl-2-methylindol-1-yl]acetic acid |
| InChIKey | JWYIGNODXSRKGP-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=CC=C2N1CC(=O)O)NC(=O)C)SC3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)