Products 802918-49-6

CAS 802918-49-6 is the registry number for Cinacalcet Impurity 74. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

1-(5,6-dihydronaphthalen-1-yl)ethanone (CAS 802918-49-6) is a chemical compound with the molecular formula C12H12O and a molecular weight of 172.22 g/mol. IUPAC name: 1-(5,6-dihydronaphthalen-1-yl)ethanone. InChIKey: UXVYXDBJXVOYQQ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12O
Molecular weight172.22 g/mol
IUPAC name1-(5,6-dihydronaphthalen-1-yl)ethanone
InChIKeyUXVYXDBJXVOYQQ-UHFFFAOYSA-N
SMILESCC(=O)C1=CC=CC2=C1C=CCC2

Computed by PubChem (NCBI)