CAS 80300-30-7 is the registry number for 2,3,4,6-Tetra-O-benzyl-D-glucopyranosyl Acetate. Offered by: TRC. Available pack sizes: 2,5g.
[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] acetate (CAS 80300-30-7) is a chemical compound with the molecular formula C36H38O7 and a molecular weight of 582.7 g/mol. IUPAC name: [(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] acetate. InChIKey: YYFLBSFJOGQSRA-KXCACMGXSA-N.
| Molecular formula | C36H38O7 |
|---|---|
| Molecular weight | 582.7 g/mol |
| IUPAC name | [(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] acetate |
| InChIKey | YYFLBSFJOGQSRA-KXCACMGXSA-N |
| SMILES | CC(=O)OC1[C@@H]([C@H]([C@@H]([C@H](O1)COCC2=CC=CC=C2)OCC3=CC=CC=C3)OCC4=CC=CC=C4)OCC5=CC=CC=C5 |
Computed by PubChem (NCBI)