Products 803712-79-0
CAS 803712-79-0 appears in our catalog under these names: Obatoclax mesylate, 95%, Obatoclax mesylate (GX15–070), Obatoclax Mesylate/ 99.38% (existing batch purity), Obatoclax mesylate, Obatoclax Mesylate 99%. Offered by: Combi-blocks, GLPBio, TargetMol, Biosynth, Ambeed. Available pack sizes: 250mg, 100mg, 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 1mg.
(2Z)-2-[(5Z)-5-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methoxypyrrol-2-ylidene]indole;methanesulfonic acid (CAS 803712-79-0) is a chemical compound with the molecular formula C21H23N3O4S and a molecular weight of 413.5 g/mol. IUPAC name: (2Z)-2-[(5Z)-5-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methoxypyrrol-2-ylidene]indole;methanesulfonic acid. InChIKey: ZVAGBRFUYHSUHA-LZOXOEDVSA-N.
| Molecular formula | C21H23N3O4S |
|---|---|
| Molecular weight | 413.5 g/mol |
| IUPAC name | (2Z)-2-[(5Z)-5-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methoxypyrrol-2-ylidene]indole;methanesulfonic acid |
| InChIKey | ZVAGBRFUYHSUHA-LZOXOEDVSA-N |
| SMILES | CC1=CC(=C(N1)/C=C\2/C(=C/C(=C/3\C=C4C=CC=CC4=N3)/N2)OC)C.CS(=O)(=O)O |
Computed by PubChem (NCBI)