CAS 80395-12-6 is the registry number for 3-Bromobenzylphosphonic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(3-bromophenyl)methylphosphonic acid (CAS 80395-12-6) is a chemical compound with the molecular formula C7H8BrO3P and a molecular weight of 251.01 g/mol. IUPAC name: (3-bromophenyl)methylphosphonic acid. InChIKey: IQYFBQGTSGSWHQ-UHFFFAOYSA-N.
| Molecular formula | C7H8BrO3P |
|---|---|
| Molecular weight | 251.01 g/mol |
| IUPAC name | (3-bromophenyl)methylphosphonic acid |
| InChIKey | IQYFBQGTSGSWHQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)CP(=O)(O)O |
Computed by PubChem (NCBI)