Products 80407-73-4
CAS 80407-73-4 is the registry number for Ornithine-methotrexate. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-5-amino-2-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]pentanoic acid (CAS 80407-73-4) is a chemical compound with the molecular formula C20H25N9O3 and a molecular weight of 439.5 g/mol. IUPAC name: (2S)-5-amino-2-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]pentanoic acid. InChIKey: XZMFYMLGNMSYOG-AWEZNQCLSA-N.
| Molecular formula | C20H25N9O3 |
|---|---|
| Molecular weight | 439.5 g/mol |
| IUPAC name | (2S)-5-amino-2-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]pentanoic acid |
| InChIKey | XZMFYMLGNMSYOG-AWEZNQCLSA-N |
| SMILES | CN(CC1=CN=C2C(=N1)C(=NC(=N2)N)N)C3=CC=C(C=C3)C(=O)N[C@@H](CCCN)C(=O)O |
Computed by PubChem (NCBI)