CAS 80430-23-5 is the registry number for Methyl-2-Methane Sulfonyloxy-5-Nitro-Benzoate. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-methylsulfonyloxy-5-nitrobenzoate (CAS 80430-23-5) is a chemical compound with the molecular formula C9H9NO7S and a molecular weight of 275.24 g/mol. IUPAC name: methyl 2-methylsulfonyloxy-5-nitrobenzoate. InChIKey: BDSHDAZYGZUZQM-UHFFFAOYSA-N.
| Molecular formula | C9H9NO7S |
|---|---|
| Molecular weight | 275.24 g/mol |
| IUPAC name | methyl 2-methylsulfonyloxy-5-nitrobenzoate |
| InChIKey | BDSHDAZYGZUZQM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)[N+](=O)[O-])OS(=O)(=O)C |
Computed by PubChem (NCBI)