CAS 80433-71-2 appears in our catalog under these names: Calcium Levofolinate, >95% (HPLC), Levoleucovorin Calcium/ 98.46% (existing batch purity), Levoleucovorin Calcium, Levoleucovorin Calcium 98%, Calcium Levofolinate, 98%, 98%. Offered by: TRC, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 5mg, 50mg, 500mg, 10mg, 10g, 250mg.
Calcium (2S)-2-[[4-[[(6S)-2-amino-5-formyl-4-oxo-3,6,7,8-tetrahydropteridin-6-yl]methylamino]benzoyl]amino]pentanedioate (CAS 80433-71-2) is a chemical compound with the molecular formula C20H21CaN7O7 and a molecular weight of 511.5 g/mol. IUPAC name: calcium (2S)-2-[[4-[[(6S)-2-amino-5-formyl-4-oxo-3,6,7,8-tetrahydropteridin-6-yl]methylamino]benzoyl]amino]pentanedioate. InChIKey: KVUAALJSMIVURS-QNTKWALQSA-L.
| Molecular formula | C20H21CaN7O7 |
|---|---|
| Molecular weight | 511.5 g/mol |
| IUPAC name | calcium (2S)-2-[[4-[[(6S)-2-amino-5-formyl-4-oxo-3,6,7,8-tetrahydropteridin-6-yl]methylamino]benzoyl]amino]pentanedioate |
| InChIKey | KVUAALJSMIVURS-QNTKWALQSA-L |
| SMILES | C1[C@@H](N(C2=C(N1)N=C(NC2=O)N)C=O)CNC3=CC=C(C=C3)C(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-].[Ca+2] |
Computed by PubChem (NCBI)