Products 80434-33-9
CAS 80434-33-9 appears in our catalog under these names: Gamma-diasarone, γ-Diasarone. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, Get quote.
(1S,2S,3S)-1-ethyl-4,5,7-trimethoxy-2-methyl-3-(2,4,5-trimethoxyphenyl)-2,3-dihydro-1H-indene (CAS 80434-33-9) is a chemical compound with the molecular formula C24H32O6 and a molecular weight of 416.5 g/mol. IUPAC name: (1S,2S,3S)-1-ethyl-4,5,7-trimethoxy-2-methyl-3-(2,4,5-trimethoxyphenyl)-2,3-dihydro-1H-indene. InChIKey: ZPOQFZFDKXZAGL-RXSFTSLZSA-N.
| Molecular formula | C24H32O6 |
|---|---|
| Molecular weight | 416.5 g/mol |
| IUPAC name | (1S,2S,3S)-1-ethyl-4,5,7-trimethoxy-2-methyl-3-(2,4,5-trimethoxyphenyl)-2,3-dihydro-1H-indene |
| InChIKey | ZPOQFZFDKXZAGL-RXSFTSLZSA-N |
| SMILES | CC[C@H]1[C@@H]([C@H](C2=C1C(=CC(=C2OC)OC)OC)C3=CC(=C(C=C3OC)OC)OC)C |
Computed by PubChem (NCBI)