Products 804425-95-4

CAS 804425-95-4 appears in our catalog under these names: 1-Thia-4-azaspiro[4.4]nonane-3-carboxylic acid hydrochloride, 95%, 1-Thia-4-azaspiro[4.4]nonane-3-carboxylic acid 95+%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 250mg, 1g, 50mg, 100mg.

Structural formula: {0} (CAS {1})

1-thia-4-azaspiro[4.4]nonane-3-carboxylic acid (CAS 804425-95-4) is a chemical compound with the molecular formula C8H13NO2S and a molecular weight of 187.26 g/mol. IUPAC name: 1-thia-4-azaspiro[4.4]nonane-3-carboxylic acid. InChIKey: LNFDZRROXCWEQT-UHFFFAOYSA-N.

Identity
Molecular formulaC8H13NO2S
Molecular weight187.26 g/mol
IUPAC name1-thia-4-azaspiro[4.4]nonane-3-carboxylic acid
InChIKeyLNFDZRROXCWEQT-UHFFFAOYSA-N
SMILESC1CCC2(C1)NC(CS2)C(=O)O

Computed by PubChem (NCBI)