Products 80446-29-3
CAS 80446-29-3 is the registry number for 4,5-Dibromo-1,2-cyclohexanediol. Offered by: TRC. Available pack sizes: 500mg.
(1R,2S,4R,5R)-4,5-dibromocyclohexane-1,2-diol (CAS 80446-29-3) is a chemical compound with the molecular formula C6H10Br2O2 and a molecular weight of 273.95 g/mol. IUPAC name: (1R,2S,4R,5R)-4,5-dibromocyclohexane-1,2-diol. InChIKey: PDKOZGHNDDCFPN-KAZBKCHUSA-N.
| Molecular formula | C6H10Br2O2 |
|---|---|
| Molecular weight | 273.95 g/mol |
| IUPAC name | (1R,2S,4R,5R)-4,5-dibromocyclohexane-1,2-diol |
| InChIKey | PDKOZGHNDDCFPN-KAZBKCHUSA-N |
| SMILES | C1[C@H]([C@H](C[C@H]([C@@H]1Br)Br)O)O |
Computed by PubChem (NCBI)