Products 71172-41-3

CAS 71172-41-3 appears in our catalog under these names: Ethyl 2,3-dibromoisobutyrate, 95%, Ethyl 2,3-dibromo-2-methylpropanoate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 5g, 0,5g.

Structural formula: {0} (CAS {1})

Ethyl 2,3-dibromo-2-methylpropanoate (CAS 71172-41-3) is a chemical compound with the molecular formula C6H10Br2O2 and a molecular weight of 273.95 g/mol. IUPAC name: ethyl 2,3-dibromo-2-methylpropanoate. InChIKey: ZYTBREBYDYHRRW-UHFFFAOYSA-N.

Identity
Molecular formulaC6H10Br2O2
Molecular weight273.95 g/mol
IUPAC nameethyl 2,3-dibromo-2-methylpropanoate
InChIKeyZYTBREBYDYHRRW-UHFFFAOYSA-N
SMILESCCOC(=O)C(C)(CBr)Br

Computed by PubChem (NCBI)