CAS 80471-69-8 appears in our catalog under these names: 2',7'-Dichlorofluorescein sodium salt, 95%, 2',7'–Dichloro–3',6'–dihydroxy–3H–spiro(isobenzofuran–1,9'–xanthen)–3–one, sodium salt, 2',7'-Dichlorofluorescein Sodium Salt, >98.0%(T), sodium 2',7'-dichloro-3-oxo-3H-spiro[isobenzofuran-1,9'-xanthene]-3',6'-bis(olate), 98%, 98%, 2,7-Dichlorofluorescein sodium salt, 98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 100mg, 250mg, 10g.
Disodium;2-(2,7-dichloro-3-oxido-6-oxoxanthen-9-yl)benzoate (CAS 80471-69-8) is a chemical compound with the molecular formula C20H8Cl2Na2O5 and a molecular weight of 445.2 g/mol. IUPAC name: disodium;2-(2,7-dichloro-3-oxido-6-oxoxanthen-9-yl)benzoate. InChIKey: SZSVOWHDMGIUKH-UHFFFAOYSA-L.
| Molecular formula | C20H8Cl2Na2O5 |
|---|---|
| Molecular weight | 445.2 g/mol |
| IUPAC name | disodium;2-(2,7-dichloro-3-oxido-6-oxoxanthen-9-yl)benzoate |
| InChIKey | SZSVOWHDMGIUKH-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C(=C1)C2=C3C=C(C(=O)C=C3OC4=CC(=C(C=C42)Cl)[O-])Cl)C(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)