CAS 80490-83-1 is the registry number for N-(3,4-dichlorophenyl)(4-(N-(3,4-dichlorophenyl)carbamoyl)piperazinyl)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
1-N,4-N-bis(3,4-dichlorophenyl)piperazine-1,4-dicarboxamide (CAS 80490-83-1) is a chemical compound with the molecular formula C18H16Cl4N4O2 and a molecular weight of 462.2 g/mol. IUPAC name: 1-N,4-N-bis(3,4-dichlorophenyl)piperazine-1,4-dicarboxamide. InChIKey: FLIDYGNKBVLJOW-UHFFFAOYSA-N.
| Molecular formula | C18H16Cl4N4O2 |
|---|---|
| Molecular weight | 462.2 g/mol |
| IUPAC name | 1-N,4-N-bis(3,4-dichlorophenyl)piperazine-1,4-dicarboxamide |
| InChIKey | FLIDYGNKBVLJOW-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C(=O)NC2=CC(=C(C=C2)Cl)Cl)C(=O)NC3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)