Products 80514-64-3
CAS 80514-64-3 is the registry number for L-Alanine, N-(triphenylmethyl)-, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g.
(2S)-2-(tritylamino)propanoic acid (CAS 80514-64-3) is a chemical compound with the molecular formula C22H21NO2 and a molecular weight of 331.4 g/mol. IUPAC name: (2S)-2-(tritylamino)propanoic acid. InChIKey: DWQQRTJQHUWCPX-KRWDZBQOSA-N.
| Molecular formula | C22H21NO2 |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | (2S)-2-(tritylamino)propanoic acid |
| InChIKey | DWQQRTJQHUWCPX-KRWDZBQOSA-N |
| SMILES | C[C@@H](C(=O)O)NC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)