CAS 80544-17-8 appears in our catalog under these names: Cefixime Impurity 1, (Z)–2–(Methoxycarbonylmethoxyimino)–2–(2–aminothiazol–4–yl)acetic acid, (Z)-2-(2-Aminothiazol-4-yl)-2-((2-methoxy-2-oxoethoxy)imino)acetic acid 95%, (Z)-2-(2-Aminothiazol-4-yl)-2-((2-methoxy-2-oxoethoxy)imino)acetic acid, 97%, 97%, (Z)-(2-Aminothiazol-4-yl)-methoxycarbonylmethoxyiminoacetic acid, 98%. Offered by: Chemat Brand, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 100g, 25g, 500g, 1g, 10g, 5g.
(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(2-methoxy-2-oxoethoxy)iminoacetic acid (CAS 80544-17-8) is a chemical compound with the molecular formula C8H9N3O5S and a molecular weight of 259.24 g/mol. IUPAC name: (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(2-methoxy-2-oxoethoxy)iminoacetic acid. InChIKey: AGFYEFQBXHONNW-WDZFZDKYSA-N.
| Molecular formula | C8H9N3O5S |
|---|---|
| Molecular weight | 259.24 g/mol |
| IUPAC name | (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(2-methoxy-2-oxoethoxy)iminoacetic acid |
| InChIKey | AGFYEFQBXHONNW-WDZFZDKYSA-N |
| SMILES | COC(=O)CO/N=C(/C1=CSC(=N1)N)\C(=O)O |
Computed by PubChem (NCBI)