CAS 80558-61-8 is the registry number for MB-28767. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-[(1R,2R)-2-[(E,3R)-3-hydroxy-4-phenoxybut-1-enyl]-5-oxocyclopentyl]heptanoic acid (CAS 80558-61-8) is a chemical compound with the molecular formula C22H30O5 and a molecular weight of 374.5 g/mol. IUPAC name: 7-[(1R,2R)-2-[(E,3R)-3-hydroxy-4-phenoxybut-1-enyl]-5-oxocyclopentyl]heptanoic acid. InChIKey: NZGFSDWJUZOAAX-KAVAACISSA-N.
| Molecular formula | C22H30O5 |
|---|---|
| Molecular weight | 374.5 g/mol |
| IUPAC name | 7-[(1R,2R)-2-[(E,3R)-3-hydroxy-4-phenoxybut-1-enyl]-5-oxocyclopentyl]heptanoic acid |
| InChIKey | NZGFSDWJUZOAAX-KAVAACISSA-N |
| SMILES | C1CC(=O)[C@@H]([C@H]1/C=C/[C@H](COC2=CC=CC=C2)O)CCCCCCC(=O)O |
Computed by PubChem (NCBI)