Products 80563-82-2

CAS 80563-82-2 appears in our catalog under these names: 3,5-Dimethoxybenzene-1-sulfonyl chloride, 95%, 3,5-dimethoxybenzene-1-sulfonyl chloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

1,6-dimethoxycyclohexa-2,4-diene-1-sulfonyl chloride (CAS 80563-82-2) is a chemical compound with the molecular formula C8H11ClO4S and a molecular weight of 238.69 g/mol. IUPAC name: 1,6-dimethoxycyclohexa-2,4-diene-1-sulfonyl chloride. InChIKey: SMVJRAIGMMKIGN-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11ClO4S
Molecular weight238.69 g/mol
IUPAC name1,6-dimethoxycyclohexa-2,4-diene-1-sulfonyl chloride
InChIKeySMVJRAIGMMKIGN-UHFFFAOYSA-N
SMILESCOC1C=CC=CC1(OC)S(=O)(=O)Cl

Computed by PubChem (NCBI)