CAS 80566-25-2 appears in our catalog under these names: 3-Ethyl-1,1,2-trimethyl-1H-benzo[e]indol-3-ium Iodide, >98.0%(HPLC)(T), 3-ethyl-1,1,2-trimethyl-1H-benzo[e]indol-3-ium iodide, 98%, 98%. Offered by: TCI, Chemat. Available pack sizes: 5g, 25g.
3-ethyl-1,1,2-trimethylbenzo[e]indol-3-ium iodide (CAS 80566-25-2) is a chemical compound with the molecular formula C17H20IN and a molecular weight of 365.25 g/mol. IUPAC name: 3-ethyl-1,1,2-trimethylbenzo[e]indol-3-ium iodide. InChIKey: BPKOQZARSBBQRG-UHFFFAOYSA-M.
| Molecular formula | C17H20IN |
|---|---|
| Molecular weight | 365.25 g/mol |
| IUPAC name | 3-ethyl-1,1,2-trimethylbenzo[e]indol-3-ium iodide |
| InChIKey | BPKOQZARSBBQRG-UHFFFAOYSA-M |
| SMILES | CC[N+]1=C(C(C2=C1C=CC3=CC=CC=C32)(C)C)C.[I-] |
Computed by PubChem (NCBI)