Products 80576-77-8
CAS 80576-77-8 is the registry number for 10-Methyl-10-deazaaminopterin. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-[[4-[1-(2,4-diaminopteridin-6-yl)propan-2-yl]benzoyl]amino]pentanedioic acid (CAS 80576-77-8) is a chemical compound with the molecular formula C21H23N7O5 and a molecular weight of 453.5 g/mol. IUPAC name: (2S)-2-[[4-[1-(2,4-diaminopteridin-6-yl)propan-2-yl]benzoyl]amino]pentanedioic acid. InChIKey: MQISJAZESFPIPJ-SBNLOKMTSA-N.
| Molecular formula | C21H23N7O5 |
|---|---|
| Molecular weight | 453.5 g/mol |
| IUPAC name | (2S)-2-[[4-[1-(2,4-diaminopteridin-6-yl)propan-2-yl]benzoyl]amino]pentanedioic acid |
| InChIKey | MQISJAZESFPIPJ-SBNLOKMTSA-N |
| SMILES | CC(CC1=CN=C2C(=N1)C(=NC(=N2)N)N)C3=CC=C(C=C3)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)