Products 8058-79-5
CAS 8058-79-5 is the registry number for Glutamic acid-alanine-glycine mixture. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-aminoacetic acid;(2S)-2-aminopentanedioic acid;(2S)-2-aminopropanoic acid (CAS 8058-79-5) is a chemical compound with the molecular formula C10H21N3O8 and a molecular weight of 311.29 g/mol. IUPAC name: 2-aminoacetic acid;(2S)-2-aminopentanedioic acid;(2S)-2-aminopropanoic acid. InChIKey: RBPVKPJDVPPRMI-AVXONLMPSA-N.
| Molecular formula | C10H21N3O8 |
|---|---|
| Molecular weight | 311.29 g/mol |
| IUPAC name | 2-aminoacetic acid;(2S)-2-aminopentanedioic acid;(2S)-2-aminopropanoic acid |
| InChIKey | RBPVKPJDVPPRMI-AVXONLMPSA-N |
| SMILES | C[C@@H](C(=O)O)N.C(CC(=O)O)[C@@H](C(=O)O)N.C(C(=O)O)N |
Computed by PubChem (NCBI)