CAS 80584-91-4 appears in our catalog under these names: 2,4,6–Tri–(6–aminocaproic acid)–1,3,5–triazine, 2,4,6-Tri-(6-aminocaproic acid)-1,3,5-triazine, 1,3,5-Triazine-2,4,6-triaminocaproic acid, 90%, 90%, 2,4,6-Tri-(6-aminocaproic acid)-1,3,5-tr, iazine, 500 g, 2,4,6-Tri-(6-aminocaproic acid)-1,3,5-tr, iazine, 1 kg. Offered by: GLPBio, Biosynth, Chemat, Roth. Available pack sizes: 5g, 1kg, 0,5kg, 2kg, 5kg, 10kg, 100mg, 250mg.
6-[[4,6-bis(5-carboxypentylamino)-1,3,5-triazin-2-yl]amino]hexanoic acid (CAS 80584-91-4) is a chemical compound with the molecular formula C21H36N6O6 and a molecular weight of 468.5 g/mol. IUPAC name: 6-[[4,6-bis(5-carboxypentylamino)-1,3,5-triazin-2-yl]amino]hexanoic acid. InChIKey: BKKWPPMEXIXECW-UHFFFAOYSA-N.
| Molecular formula | C21H36N6O6 |
|---|---|
| Molecular weight | 468.5 g/mol |
| IUPAC name | 6-[[4,6-bis(5-carboxypentylamino)-1,3,5-triazin-2-yl]amino]hexanoic acid |
| InChIKey | BKKWPPMEXIXECW-UHFFFAOYSA-N |
| SMILES | C(CCC(=O)O)CCNC1=NC(=NC(=N1)NCCCCCC(=O)O)NCCCCCC(=O)O |
Computed by PubChem (NCBI)