CAS 80585-40-6 is the registry number for 4,6-Dimethoxybenzene-1,3-disulfonyl dichloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4,6-dimethoxybenzene-1,3-disulfonyl chloride (CAS 80585-40-6) is a chemical compound with the molecular formula C8H8Cl2O6S2 and a molecular weight of 335.2 g/mol. IUPAC name: 4,6-dimethoxybenzene-1,3-disulfonyl chloride. InChIKey: SDKJJAKGOABBBD-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2O6S2 |
|---|---|
| Molecular weight | 335.2 g/mol |
| IUPAC name | 4,6-dimethoxybenzene-1,3-disulfonyl chloride |
| InChIKey | SDKJJAKGOABBBD-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1S(=O)(=O)Cl)S(=O)(=O)Cl)OC |
Computed by PubChem (NCBI)