Products 80585-40-6

CAS 80585-40-6 is the registry number for 4,6-Dimethoxybenzene-1,3-disulfonyl dichloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

4,6-dimethoxybenzene-1,3-disulfonyl chloride (CAS 80585-40-6) is a chemical compound with the molecular formula C8H8Cl2O6S2 and a molecular weight of 335.2 g/mol. IUPAC name: 4,6-dimethoxybenzene-1,3-disulfonyl chloride. InChIKey: SDKJJAKGOABBBD-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8Cl2O6S2
Molecular weight335.2 g/mol
IUPAC name4,6-dimethoxybenzene-1,3-disulfonyl chloride
InChIKeySDKJJAKGOABBBD-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1S(=O)(=O)Cl)S(=O)(=O)Cl)OC

Computed by PubChem (NCBI)