Products 805945-90-8
CAS 805945-90-8 is the registry number for 1-(2,4-Dimethylphenyl)-2-((propan-2-yl)amino)propan-1-one. Offered by: Biosynth. Available pack sizes: 100mg, 250mg.
1-(2,4-dimethylphenyl)-2-(propan-2-ylamino)propan-1-one (CAS 805945-90-8) is a chemical compound with the molecular formula C14H21NO and a molecular weight of 219.32 g/mol. IUPAC name: 1-(2,4-dimethylphenyl)-2-(propan-2-ylamino)propan-1-one. InChIKey: SBRJGKVRANDJEP-UHFFFAOYSA-N.
| Molecular formula | C14H21NO |
|---|---|
| Molecular weight | 219.32 g/mol |
| IUPAC name | 1-(2,4-dimethylphenyl)-2-(propan-2-ylamino)propan-1-one |
| InChIKey | SBRJGKVRANDJEP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)C(C)NC(C)C)C |
Computed by PubChem (NCBI)