Products 80604-17-7
CAS 80604-17-7 is the registry number for 2',5,6',7-Tetraacetoxyflavanone. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, Get quote.
[3-acetyloxy-2-(5,7-diacetyloxy-4-oxo-2,3-dihydrochromen-2-yl)phenyl] acetate (CAS 80604-17-7) is a chemical compound with the molecular formula C23H20O10 and a molecular weight of 456.4 g/mol. IUPAC name: [3-acetyloxy-2-(5,7-diacetyloxy-4-oxo-2,3-dihydrochromen-2-yl)phenyl] acetate. InChIKey: QAJSRSKXTOZULY-UHFFFAOYSA-N.
| Molecular formula | C23H20O10 |
|---|---|
| Molecular weight | 456.4 g/mol |
| IUPAC name | [3-acetyloxy-2-(5,7-diacetyloxy-4-oxo-2,3-dihydrochromen-2-yl)phenyl] acetate |
| InChIKey | QAJSRSKXTOZULY-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C(=CC=C1)OC(=O)C)C2CC(=O)C3=C(O2)C=C(C=C3OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)