CAS 80629-35-2 appears in our catalog under these names: (2S)-1-((2S)-3-Bromo-2-methylpropanoyl)pyrrolidine-2-carboxylic Acid, Captopril EP Impurity B, Captopril EP Impurity B (Standard). Offered by: Mikromol, Chemat Brand, MedChemExpress. Available pack sizes: 25mg, on request, Get quote.
(2S)-1-[(2S)-3-bromo-2-methylpropanoyl]pyrrolidine-2-carboxylic acid (CAS 80629-35-2) is a chemical compound with the molecular formula C9H14BrNO3 and a molecular weight of 264.12 g/mol. IUPAC name: (2S)-1-[(2S)-3-bromo-2-methylpropanoyl]pyrrolidine-2-carboxylic acid. InChIKey: SJYSAVFKJLHJHP-RQJHMYQMSA-N.
| Molecular formula | C9H14BrNO3 |
|---|---|
| Molecular weight | 264.12 g/mol |
| IUPAC name | (2S)-1-[(2S)-3-bromo-2-methylpropanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | SJYSAVFKJLHJHP-RQJHMYQMSA-N |
| SMILES | C[C@H](CBr)C(=O)N1CCC[C@H]1C(=O)O |
Computed by PubChem (NCBI)