CAS 8064-90-2 appears in our catalog under these names: Cotrimoxazole, Cotrimoxazole, >95% (HPLC), Trimosulfa, Cotrimoxazole, Ready Made Solution, 100&, Co-trimoxazole, 99.93% ,, 99.93% ,. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Sigma-Aldrich. Available pack sizes: on request, 1g, 2,5g, 25g, 25mg, 250mg, 10mM (in 1ml dmso), 500mg.
4-amino-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide;5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine-2,4-diamine (CAS 8064-90-2) is a chemical compound with the molecular formula C24H29N7O6S and a molecular weight of 543.6 g/mol. IUPAC name: 4-amino-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide;5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine-2,4-diamine. InChIKey: WZRJTRPJURQBRM-UHFFFAOYSA-N.
| Molecular formula | C24H29N7O6S |
|---|---|
| Molecular weight | 543.6 g/mol |
| IUPAC name | 4-amino-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide;5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine-2,4-diamine |
| InChIKey | WZRJTRPJURQBRM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NO1)NS(=O)(=O)C2=CC=C(C=C2)N.COC1=CC(=CC(=C1OC)OC)CC2=CN=C(N=C2N)N |
Computed by PubChem (NCBI)