CAS 80685-25-2 is the registry number for 2,2'-(Ethane-1,2-diylbis(oxy))bis(ethan-1-amine) dihydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g, 10g, 5g.
4-iodo-2-methyl-6-nitroaniline (CAS 80685-25-2) is a chemical compound with the molecular formula C7H7IN2O2 and a molecular weight of 278.05 g/mol. IUPAC name: 4-iodo-2-methyl-6-nitroaniline. InChIKey: QDOSZZJIJPEKSP-UHFFFAOYSA-N.
| Molecular formula | C7H7IN2O2 |
|---|---|
| Molecular weight | 278.05 g/mol |
| IUPAC name | 4-iodo-2-methyl-6-nitroaniline |
| InChIKey | QDOSZZJIJPEKSP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1N)[N+](=O)[O-])I |
Computed by PubChem (NCBI)