CAS 80721-47-7 appears in our catalog under these names: Pyrroloquinoline quinone Impurity 1, Pyrroloquinoline Impurity 1, 7,9-Dimethoxycarbonyl-2-ethoxycarbonyl-1H-pyrrolo-(2,3-f)quinoline-4,5-dione. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 2,5mg.
2-O-ethyl 7-O,9-O-dimethyl 4,5-dioxo-1H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylate (CAS 80721-47-7) is a chemical compound with the molecular formula C18H14N2O8 and a molecular weight of 386.3 g/mol. IUPAC name: 2-O-ethyl 7-O,9-O-dimethyl 4,5-dioxo-1H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylate. InChIKey: YYWXAGSZHNRGHM-UHFFFAOYSA-N.
| Molecular formula | C18H14N2O8 |
|---|---|
| Molecular weight | 386.3 g/mol |
| IUPAC name | 2-O-ethyl 7-O,9-O-dimethyl 4,5-dioxo-1H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylate |
| InChIKey | YYWXAGSZHNRGHM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1)C3=C(C(=O)C2=O)N=C(C=C3C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)