CAS 80742-11-6 appears in our catalog under these names: Nifedipine Impurity 7, Nifedipine Impurity 13, (2R,4R)-rel-1,2,3,4-Tetrahydro-6-methyl-2,4-bis(2-nitrophenyl)-5-pyrimidinecarboxylic Acid Methyl Ester, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2,5g, 250mg.
Methyl 6-methyl-2,4-bis(2-nitrophenyl)-1,2,3,4-tetrahydropyrimidine-5-carboxylate (CAS 80742-11-6) is a chemical compound with the molecular formula C19H18N4O6 and a molecular weight of 398.4 g/mol. IUPAC name: methyl 6-methyl-2,4-bis(2-nitrophenyl)-1,2,3,4-tetrahydropyrimidine-5-carboxylate. InChIKey: AANAYIQNTXWIMX-UHFFFAOYSA-N.
| Molecular formula | C19H18N4O6 |
|---|---|
| Molecular weight | 398.4 g/mol |
| IUPAC name | methyl 6-methyl-2,4-bis(2-nitrophenyl)-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| InChIKey | AANAYIQNTXWIMX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(NC(N1)C2=CC=CC=C2[N+](=O)[O-])C3=CC=CC=C3[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)