CAS 80763-60-6 appears in our catalog under these names: (2R,3S,4S,5R)–2–(ethylthio)–2,5–bis(hydroxymethyl)tetrahydrofuran–3,4–diol, Ethyl 2-thio-α-D-fructofuranoside. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 500mg, 2g.
(2R,3S,4S,5R)-2-ethylsulfanyl-2,5-bis(hydroxymethyl)oxolane-3,4-diol (CAS 80763-60-6) is a chemical compound with the molecular formula C8H16O5S and a molecular weight of 224.28 g/mol. IUPAC name: (2R,3S,4S,5R)-2-ethylsulfanyl-2,5-bis(hydroxymethyl)oxolane-3,4-diol. InChIKey: LWWCVEKTXLPUFS-OOJXKGFFSA-N.
| Molecular formula | C8H16O5S |
|---|---|
| Molecular weight | 224.28 g/mol |
| IUPAC name | (2R,3S,4S,5R)-2-ethylsulfanyl-2,5-bis(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | LWWCVEKTXLPUFS-OOJXKGFFSA-N |
| SMILES | CCS[C@@]1([C@H]([C@@H]([C@H](O1)CO)O)O)CO |
Computed by PubChem (NCBI)