CAS 80809-42-3 is the registry number for 3-Thien-2-yl[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
3-thiophen-2-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-amine (CAS 80809-42-3) is a chemical compound with the molecular formula C7H5N5S2 and a molecular weight of 223.3 g/mol. IUPAC name: 3-thiophen-2-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-amine. InChIKey: XEMVVTSATQCRRK-UHFFFAOYSA-N.
| Molecular formula | C7H5N5S2 |
|---|---|
| Molecular weight | 223.3 g/mol |
| IUPAC name | 3-thiophen-2-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-amine |
| InChIKey | XEMVVTSATQCRRK-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=NN=C3N2N=C(S3)N |
Computed by PubChem (NCBI)