CAS 808142-23-6 appears in our catalog under these names: Bis[2-(diphenylphosphino)phenyl]ether oxide, 99.5%, Bis(2-((oxo)diphenylphosphino)phenyl) ether, 95-<97%, Poly((9,9-dioctylfluorenyl-2,7-diyl)-alt-(2,6-pyridine)), DPEPO, Bis[2-[(oxo)diphenylphosphino]phenyl] Ether, >97.0%(HPLC). Offered by: Lumtec, Hoffman Fine Chemicals, GLPBio, TCI, Sigma-Aldrich. Available pack sizes: 1g, 5g, 100g, 200g, 300g, 400g, 500g, 600g.
1-diphenylphosphoryl-2-(2-diphenylphosphorylphenoxy)benzene (CAS 808142-23-6) is a chemical compound with the molecular formula C36H28O3P2 and a molecular weight of 570.6 g/mol. IUPAC name: 1-diphenylphosphoryl-2-(2-diphenylphosphorylphenoxy)benzene. InChIKey: ATTVYRDSOVWELU-UHFFFAOYSA-N.
| Molecular formula | C36H28O3P2 |
|---|---|
| Molecular weight | 570.6 g/mol |
| IUPAC name | 1-diphenylphosphoryl-2-(2-diphenylphosphorylphenoxy)benzene |
| InChIKey | ATTVYRDSOVWELU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)C3=CC=CC=C3OC4=CC=CC=C4P(=O)(C5=CC=CC=C5)C6=CC=CC=C6 |
Computed by PubChem (NCBI)