CAS 808142-24-7 appears in our catalog under these names: Phosphine oxide, (9,9-dimethyl-9h-xanthene-4,5-diyl)bis[diphenyl-, 95%, Xantphos Impurity 1, (9,9-Dimethyl-9H-xanthene-4,5-diyl)bis(diphenylphosphine oxide) 98%, (9,9-Dimethyl-9H-Xanthene-4,5-Diyl)Bis(Diphenylphosphine Oxide), 98%, 98%, 4,5-BIS(DIPHENYLPHOSPHOROSO)-9,9-DIMETHYL-9H-XANTHENE, 98%. Offered by: Combi-blocks, Chemat Brand, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, on request, 5g.
4,5-bis(diphenylphosphoryl)-9,9-dimethylxanthene (CAS 808142-24-7) is a chemical compound with the molecular formula C39H32O3P2 and a molecular weight of 610.6 g/mol. IUPAC name: 4,5-bis(diphenylphosphoryl)-9,9-dimethylxanthene. InChIKey: MLFWUIFQRRZREV-UHFFFAOYSA-N.
| Molecular formula | C39H32O3P2 |
|---|---|
| Molecular weight | 610.6 g/mol |
| IUPAC name | 4,5-bis(diphenylphosphoryl)-9,9-dimethylxanthene |
| InChIKey | MLFWUIFQRRZREV-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C(=CC=C2)P(=O)(C3=CC=CC=C3)C4=CC=CC=C4)OC5=C1C=CC=C5P(=O)(C6=CC=CC=C6)C7=CC=CC=C7)C |
Computed by PubChem (NCBI)