Products 80815-19-6

CAS 80815-19-6 is the registry number for N-Benzyl-4-phenyl pyridinium tetrafluoroborate. Offered by: Biosynth. Available pack sizes: 250mg, 500mg, 1000mg.

Structural formula: {0} (CAS {1})

1-benzyl-4-phenylpyridin-1-ium tetrafluoroborate (CAS 80815-19-6) is a chemical compound with the molecular formula C18H16BF4N and a molecular weight of 333.1 g/mol. IUPAC name: 1-benzyl-4-phenylpyridin-1-ium tetrafluoroborate. InChIKey: KVVVQQUUTKKXQQ-UHFFFAOYSA-N.

Identity
Molecular formulaC18H16BF4N
Molecular weight333.1 g/mol
IUPAC name1-benzyl-4-phenylpyridin-1-ium tetrafluoroborate
InChIKeyKVVVQQUUTKKXQQ-UHFFFAOYSA-N
SMILES[B-](F)(F)(F)F.C1=CC=C(C=C1)C[N+]2=CC=C(C=C2)C3=CC=CC=C3

Computed by PubChem (NCBI)