CAS 80815-19-6 is the registry number for N-Benzyl-4-phenyl pyridinium tetrafluoroborate. Offered by: Biosynth. Available pack sizes: 250mg, 500mg, 1000mg.
1-benzyl-4-phenylpyridin-1-ium tetrafluoroborate (CAS 80815-19-6) is a chemical compound with the molecular formula C18H16BF4N and a molecular weight of 333.1 g/mol. IUPAC name: 1-benzyl-4-phenylpyridin-1-ium tetrafluoroborate. InChIKey: KVVVQQUUTKKXQQ-UHFFFAOYSA-N.
| Molecular formula | C18H16BF4N |
|---|---|
| Molecular weight | 333.1 g/mol |
| IUPAC name | 1-benzyl-4-phenylpyridin-1-ium tetrafluoroborate |
| InChIKey | KVVVQQUUTKKXQQ-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.C1=CC=C(C=C1)C[N+]2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)