Products 808157-06-4

CAS 808157-06-4 is the registry number for 2-((3R)-5-Oxopyrrolidin-3-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-[(3R)-5-oxopyrrolidin-3-yl]acetic acid (CAS 808157-06-4) is a chemical compound with the molecular formula C6H9NO3 and a molecular weight of 143.14 g/mol. IUPAC name: 2-[(3R)-5-oxopyrrolidin-3-yl]acetic acid. InChIKey: YKTYYHBGRGVBPG-SCSAIBSYSA-N.

Identity
Molecular formulaC6H9NO3
Molecular weight143.14 g/mol
IUPAC name2-[(3R)-5-oxopyrrolidin-3-yl]acetic acid
InChIKeyYKTYYHBGRGVBPG-SCSAIBSYSA-N
SMILESC1[C@@H](CNC1=O)CC(=O)O

Computed by PubChem (NCBI)