Products 80868-90-2

CAS 80868-90-2 is the registry number for 1-Bromo-3-ethyl-5-methoxybenzene 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

1-bromo-3-ethyl-5-methoxybenzene (CAS 80868-90-2) is a chemical compound with the molecular formula C9H11BrO and a molecular weight of 215.09 g/mol. IUPAC name: 1-bromo-3-ethyl-5-methoxybenzene. InChIKey: LJOKHUXMGWVSKA-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11BrO
Molecular weight215.09 g/mol
IUPAC name1-bromo-3-ethyl-5-methoxybenzene
InChIKeyLJOKHUXMGWVSKA-UHFFFAOYSA-N
SMILESCCC1=CC(=CC(=C1)Br)OC

Computed by PubChem (NCBI)